1,6,6-TRIMETHYL-3-TERT-BUTYL-FULVENE structure
|
Common Name | 1,6,6-TRIMETHYL-3-TERT-BUTYL-FULVENE | ||
|---|---|---|---|---|
| CAS Number | 334696-50-3 | Molecular Weight | 176.29800 | |
| Density | 0.884g/cm3 | Boiling Point | 233.4ºC at 760 mmHg | |
| Molecular Formula | C13H20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83ºC | |
| Name | 3-tert-butyl-1-methyl-5-propan-2-ylidenecyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.884g/cm3 |
|---|---|
| Boiling Point | 233.4ºC at 760 mmHg |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.29800 |
| Flash Point | 83ºC |
| Exact Mass | 176.15700 |
| LogP | 4.25520 |
| Index of Refraction | 1.499 |
| InChIKey | UNGLAWCETLUCRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(C(C)(C)C)=CC1=C(C)C |
| HS Code | 2902199090 |
|---|
|
~%
1,6,6-TRIMETHYL... CAS#:334696-50-3 |
| Literature: Marin, Vladimir; Razavi, Abbas Patent: US2005/148460 A1, 2005 ; Location in patent: Page/Page column 13 ; |
|
~%
1,6,6-TRIMETHYL... CAS#:334696-50-3 |
| Literature: Mitsui Chemicals, Inc. Patent: EP1138687 A1, 2001 ; |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 1,6,6-Trimethyl-3-tert-butyl-fulvene |
| 3-tert-butyl-5,6,6-trimethylfulvene |
| 3-tert-Butyl-1,6,6-trimethylfulvene |