Fluorinert FC-75
Fluorinert FC-75 structure
|
Common Name | Fluorinert FC-75 | ||
|---|---|---|---|---|
| CAS Number | 335-36-4 | Molecular Weight | 416.060 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 96.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8F16O | Melting Point | -88°C | |
| MSDS | N/A | Flash Point | 17.6±23.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | perfluoro-2-butyltetrahydrofuran |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 96.6±40.0 °C at 760 mmHg |
| Melting Point | -88°C |
| Molecular Formula | C8F16O |
| Molecular Weight | 416.060 |
| Flash Point | 17.6±23.2 °C |
| Exact Mass | 415.969360 |
| PSA | 9.23000 |
| LogP | 6.87 |
| Vapour Pressure | 49.5±0.2 mmHg at 25°C |
| Index of Refraction | 1.278 |
| InChIKey | FYJQJMIEZVMYSD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC(F)(F)C(F)(F)C1(F)F |
| Water Solubility | Insoluble |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:111-64-8
CAS#:124-07-2
CAS#:592-94-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 206-389-5 |
| PERFLUORO-COMPOUND FC-75R |
| 2,2,3,3,4,4,5-heptafluoro-5-nonafluorobutyl-tetrahydro-furan |
| F-butyltetrahydrofuran |
| PERFLUORO-2-BUTYLTETRAHYDROFURAN |
| MFCD00014513 |
| Perfluoro(2-butyltetrahydrofuran) (so called) |
| perfluoro-2-butyl-tetrahydrofuran |
| SPECTRASYNQ PFBTHF |
| 2-Nonafluorobutyl-heptafluorotetrahydrofuran (so called) |
| FluorinertLiquid FC-75 |
| Heptafluor-2-nonafluorbutyl-tetrahydro-furan |
| 2,2,3,3,4,4,5-Heptafluoro-5-(nonafluorobutyl)tetrahydrofuran |
| FC-75 |
| FLUORINERT FC-75 |
| FLUORINERT |
| Perfluoro-compound FC-75 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of perfluoro-2-butyltetrahydrofuran? |
| A: The English name of perfluoro-2-butyltetrahydrofuran is perfluoro-2-butyltetrahydrofuran. |
| Q: How is the water solubility of perfluoro-2-butyltetrahydrofuran? |
| A: Water solubility of perfluoro-2-butyltetrahydrofuran: Insoluble. |
| Q: What is the boiling point of perfluoro-2-butyltetrahydrofuran? |
| A: Boiling point of perfluoro-2-butyltetrahydrofuran is 96.6±40.0 °C at 760 mmHg. |
| Q: What are the upstream materials of perfluoro-2-butyltetrahydrofuran? |
| A: Related upstream materials(CAS) of perfluoro-2-butyltetrahydrofuran: 111-64-8;124-07-2;592-94-9. |
| Q: What is the SMILES notation of perfluoro-2-butyltetrahydrofuran? |
| A: SMILES notation of perfluoro-2-butyltetrahydrofuran is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC(F)(F)C(F)(F)C1(F)F. |
| Q: What is the LogP of perfluoro-2-butyltetrahydrofuran? |
| A: LogP of perfluoro-2-butyltetrahydrofuran is 6.87. |
| Q: What is the CAS number of perfluoro-2-butyltetrahydrofuran? |
| A: CAS number of perfluoro-2-butyltetrahydrofuran is 335-36-4. |
| Q: What is the safety information for perfluoro-2-butyltetrahydrofuran? |
| A: Safety information for perfluoro-2-butyltetrahydrofuran: S61. |
| Q: What is the molecular formula of perfluoro-2-butyltetrahydrofuran? |
| A: Molecular formula of perfluoro-2-butyltetrahydrofuran is C8F16O. |
| Q: What is the InChIKey of perfluoro-2-butyltetrahydrofuran? |
| A: InChIKey of perfluoro-2-butyltetrahydrofuran is FYJQJMIEZVMYSD-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |