heptafluoro-2,3,3-trichlorobutane structure
|
Common Name | heptafluoro-2,3,3-trichlorobutane | ||
|---|---|---|---|---|
| CAS Number | 335-44-4 | Molecular Weight | 287.39100 | |
| Density | 1.748 | Boiling Point | 98 °C | |
| Molecular Formula | C4Cl3F7 | Melting Point | 4°C | |
| MSDS | N/A | Flash Point | 97-98°C | |
| Name | 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.748 |
|---|---|
| Boiling Point | 98 °C |
| Melting Point | 4°C |
| Molecular Formula | C4Cl3F7 |
| Molecular Weight | 287.39100 |
| Flash Point | 97-98°C |
| Exact Mass | 285.89500 |
| LogP | 4.18950 |
| Index of Refraction | 1.353 |
| InChIKey | ZPGMWBFCBUKITA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(Cl)C(Cl)(Cl)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2903799090 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| hepta-fluoro-2,3,3-trichlorobutane |
| 2,2,3-Trichloroheptafluorobutane |
| MFCD00018065 |
| 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluoro-butane |
| HEPTAFLUORO-2,2,3-TRICHLOROBUTANE |
| Heptafluoro-2,3,3-trichlorobutane |
| Butane,2,2,3-trichloro-1,1,1,3,4,4,4-heptafluoro |
| 2,2,3-Trichlor-heptafluor-butan |