hexafluoro-2,2,3,3-tetrachlorobutane structure
|
Common Name | hexafluoro-2,2,3,3-tetrachlorobutane | ||
|---|---|---|---|---|
| CAS Number | 375-34-8 | Molecular Weight | 303.84500 | |
| Density | 1.76 | Boiling Point | 131 °C | |
| Molecular Formula | C4Cl4F6 | Melting Point | 83 °C | |
| MSDS | N/A | Flash Point | 45.1ºC | |
| Name | 2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76 |
|---|---|
| Boiling Point | 131 °C |
| Melting Point | 83 °C |
| Molecular Formula | C4Cl4F6 |
| Molecular Weight | 303.84500 |
| Flash Point | 45.1ºC |
| Exact Mass | 301.86600 |
| LogP | 4.45880 |
| Index of Refraction | 1.388 |
| InChIKey | BZBLUUDREZEDDJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(Cl)(Cl)C(Cl)(Cl)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2903799090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 206-787-9 |
| MFCD00042088 |
| 1,1,1,4,4,4-hexa-fluoro-2,2,3,3-tetrachlorobutane |
| Butane,2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluoro |
| Butane S2-46 |
| 2,2,3,3-tetrachloro-1,1,1,4,4,4-hexafluoro-butane |
| FC 316maa |
| Butane,2,2,3,3-tetrachlorohexafluoro |
| CFC 316 |
| 2,2,3,3-Tetrachlor-hexafluor-butan |
| 2,2,3,3-tetrachloro-hexafluoro-butane |