1-Iodo-1H,1H-perfluorohexane structure
|
Common Name | 1-Iodo-1H,1H-perfluorohexane | ||
|---|---|---|---|---|
| CAS Number | 335-50-2 | Molecular Weight | 409.96700 | |
| Density | 1.984g/cm3 | Boiling Point | 140.6ºC at 760 mmHg | |
| Molecular Formula | C6H2F11I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 54.7ºC | |
| Name | 1-Iodo-1H,1H-perfluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.984g/cm3 |
|---|---|
| Boiling Point | 140.6ºC at 760 mmHg |
| Molecular Formula | C6H2F11I |
| Molecular Weight | 409.96700 |
| Flash Point | 54.7ºC |
| Exact Mass | 409.90300 |
| LogP | 4.52490 |
| Index of Refraction | 1.349 |
| InChIKey | NVPYUCSZZRWYML-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CI |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903799090 |
|
~%
1-Iodo-1H,1H-pe... CAS#:335-50-2 |
| Literature: Tiers et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5978 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-iodohexane |