1H,1H-Perfluorohexyl p-toluenesulfonate structure
|
Common Name | 1H,1H-Perfluorohexyl p-toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 355-77-1 | Molecular Weight | 454.25600 | |
| Density | 1.531g/cm3 | Boiling Point | 336.1ºC at 760 mmHg | |
| Molecular Formula | C13H9F11O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110 | |
| Name | 1H,1H-Perfluorohexyl p-toluenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 336.1ºC at 760 mmHg |
| Molecular Formula | C13H9F11O3S |
| Molecular Weight | 454.25600 |
| Flash Point | >110 |
| Exact Mass | 454.01000 |
| PSA | 51.75000 |
| LogP | 5.88460 |
| Index of Refraction | 1.394 |
| InChIKey | HDIPCCMMPQAPRF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2905590090 |
|
~%
1H,1H-Perfluoro... CAS#:355-77-1 |
| Literature: Tiers et al. Journal of the American Chemical Society, 1953 , vol. 7, p. 5978 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexyl 4-methylbenzenesulfonate |