perfluoro-n-heptyl iodide structure
|
Common Name | perfluoro-n-heptyl iodide | ||
|---|---|---|---|---|
| CAS Number | 335-58-0 | Molecular Weight | 495.95500 | |
| Density | 2,01 g/cm3 | Boiling Point | 137 °C | |
| Molecular Formula | C7F15I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137-138°C | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-7-iodoheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 2,01 g/cm3 |
|---|---|
| Boiling Point | 137 °C |
| Molecular Formula | C7F15I |
| Molecular Weight | 495.95500 |
| Flash Point | 137-138°C |
| Exact Mass | 495.88100 |
| LogP | 5.75300 |
| Index of Refraction | 1.329 |
| InChIKey | AHUMDLIBMIYQMU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
|
~%
perfluoro-n-hep... CAS#:335-58-0 |
| Literature: Journal of the Chemical Society, , p. 3761,3766 |
|
~%
Detail
|
| Literature: Journal of Physical Chemistry, , vol. 94, # 16 p. 6332 - 6337 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Perfluoro-n-heptyl iodide |
| 1-iodopentadecafluoroheptane |
| 1-iodoperfluoroheptane |
| 1-iodoperfluoro-n-heptane |
| MFCD00013712 |
| EINECS 206-393-7 |
| Perfluoroheptyl iodide |