Perfluorocapric acid structure
|
Common Name | Perfluorocapric acid | ||
|---|---|---|---|---|
| CAS Number | 335-76-2 | Molecular Weight | 514.083 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 219.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C10HF19O2 | Melting Point | 77-81 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 82.7±25.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | perfluorodecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 219.0±0.0 °C at 760 mmHg |
| Melting Point | 77-81 °C(lit.) |
| Molecular Formula | C10HF19O2 |
| Molecular Weight | 514.083 |
| Flash Point | 82.7±25.9 °C |
| Exact Mass | 513.967285 |
| PSA | 37.30000 |
| LogP | 9.53 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.289 |
| InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | 2-8°C |
| Stability | Stable. Incompatible with strong bases, oxidizing agents, reducing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HD9900000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2915900090 |
|
~%
Perfluorocapric acid CAS#:335-76-2 |
| Literature: Industrial and Engineering Chemistry, , vol. 43, p. 2332 DE836796 , ; DRP/DRBP Org.Chem. |
|
~%
Perfluorocapric acid CAS#:335-76-2 |
| Literature: Industrial and Engineering Chemistry, , vol. 43, p. 2332 DE836796 , ; DRP/DRBP Org.Chem. |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Occurrence of perfluorinated alkyl substances in sediment from estuarine and coastal areas of the East China Sea.
Environ. Sci. Pollut. Res. Int. 22(3) , 1662-9, (2015) Perfluorinated alkyl substances (PFAS) have drawn much attention due to their environmental persistence, ubiquitous existence, and bioaccumulation potential. The occurrence and spatial variation of PF... |
|
|
Associations between perfluoroalkyl compounds and immune and clinical chemistry parameters in highly exposed bottlenose dolphins (Tursiops truncatus).
Environ. Toxicol. Chem. 32(4) , 736-46, (2013) Perfluoroalkyl compounds (PFCs) are ubiquitous, persistent chemical contaminants found in the environment, wildlife, and humans. Despite the widespread occurrence of PFCs, little is known about the im... |
|
|
Perfluoroalkyl acids in blood serum samples from children in Taiwan.
Environ. Sci. Pollut. Res. Int. , (2014) Severe perfluoroalkyl acid (PFAA) contamination resulting from the fast-growing semiconductor, electrochemical, and optoelectronic industries has been determined in the river water in the vicinity of ... |
| Nonadecafluorocapric acid |
| DECANOIC ACID,NONADECAFLUORO |
| Nonadecafluorodecanoic acid |
| perfluoro-1-decanoic acid |
| EINECS 206-400-3 |
| perflurodecanoic acid |
| Perfluorodecanoic acid |
| MFCD00004175 |
| perfluoro-n-decanoic acid |
| PFDA |
| Nonadecafluoro-n-decanoic acid |
| Ndfda |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
| Decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro- |
| Perfluorocapric acid |