A-315675 structure
|
Common Name | A-315675 | ||
|---|---|---|---|---|
| CAS Number | 335679-69-1 | Molecular Weight | 326.43100 | |
| Density | 1.101g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C17H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
Use of A-315675A-315675 is a potent highly potent inhibitor of A and B strain influenza virus neuraminidases inhibitor[1]. |
| Name | (2R,4S,5R)-5-[(1R,2S)-1-acetamido-2-methoxy-2-methylpentyl]-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | A-315675 is a potent highly potent inhibitor of A and B strain influenza virus neuraminidases inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.43100 |
| Flash Point | 268.8ºC |
| Exact Mass | 326.22100 |
| PSA | 91.15000 |
| LogP | 2.87280 |
| Index of Refraction | 1.523 |
| InChIKey | UUVKABIGWGMYCE-FLMGFEAJSA-N |
| SMILES | CC=CC1CC(C(=O)O)NC1C(NC(C)=O)C(C)(CCC)OC |
| D-Proline,5-[(1R,2S)-1-(acetylamino)-2-methoxy-2-methylpentyl]-4-(1Z)-1-propenyl-,(4S,5R) |
| (5R)-((1R)-acetylamino-(2S)-methoxy-(2S)-methylpentyl)-(4S)-Z-propenylpyrrolidine-(2R)-carboxylic acid |
| 5-[(1R,2S)-1-(acetylamino)-2-methoxy-2-methylpentyl]-4-[(1Z)-1-propenyl]-(4S,5R)-D-proline |
| (-)-(2R,4S,5R)-5-[(1R,2S)-1-(acetylamino)-2-methoxy-2-methylpentyl]-4-[(1Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
| 5-[(2S,1R)-1-(Acetylamino)-2-methoxy-2-methylpentyl](4S,2R)-4-(prop-1-enyl)pyrrolidine-2-carboxylic acid |
| (+-)-(2R,3S,5R,1'R,2'S)-2-(1-Acetamido-2-methyl-2-methoxy)pentyl-3-(cis-propen-1-yl)-pyrrolidine-5-carboxylic Acid |