5,5-Dimethyl-3-pyrrolidino-cyclohex-2-en-1-one structure
|
Common Name | 5,5-Dimethyl-3-pyrrolidino-cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 3357-16-2 | Molecular Weight | 193.28500 | |
| Density | 1.038g/cm3 | Boiling Point | 288.7ºC at 760 mmHg | |
| Molecular Formula | C12H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.8ºC | |
| Name | 5,5-dimethyl-3-pyrrolidin-1-ylcyclohex-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 288.7ºC at 760 mmHg |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.28500 |
| Flash Point | 99.8ºC |
| Exact Mass | 193.14700 |
| PSA | 20.31000 |
| LogP | 2.29310 |
| Index of Refraction | 1.522 |
| InChIKey | QUHBLBSKTJUBLZ-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C=C(N2CCCC2)C1 |
| HS Code | 2933990090 |
|---|
|
~%
5,5-Dimethyl-3-... CAS#:3357-16-2 |
| Literature: Bilbao, Estibaliz R.; Alvarado, Mario; Masaguer, Christian F.; Ravina, Enrique Tetrahedron Letters, 2002 , vol. 43, # 19 p. 3551 - 3554 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5-Dimethyl-3-pyrrolidinocyclohex-2-en-1-on |
| 5,5-Dimethyl-3-pyrrolidin-1-yl-cyclohex-2-enone |
| 3-pyrrolidino-5,5-dimethylcyclohex-2-en-1-one |
| 5,5-Dimethyl-3-pyrrolidino-cyclohex-2-en-1-one |
| 5,5-dimethyl-3-pyrrolidino-2-cyclohexenone |