5,5-diethyl-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione structure
|
Common Name | 5,5-diethyl-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 3362-19-4 | Molecular Weight | 214.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5-diethyl-1-methyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14N2O2S |
|---|---|
| Molecular Weight | 214.28500 |
| Exact Mass | 214.07800 |
| PSA | 84.99000 |
| LogP | 0.87970 |
| InChIKey | DDGRZXJIANCRAC-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)NC(=S)N(C)C1=O |
|
~%
5,5-diethyl-1-m... CAS#:3362-19-4 |
| Literature: Crossley et al. Journal of Organic Chemistry, 1940 , vol. 5, p. 238,240 |
|
~%
Detail
|
| Literature: Crossley et al. Journal of Organic Chemistry, 1940 , vol. 5, p. 238,240 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 5,5-Diaethyl-1-methyl-2-thio-barbitursaeure |
| N-Methyl-5.5-diaethyl-2-thio-barbitursaeure |
| 5,5-diethyl-1-methyl-2-thioxo-1,3,5-trihydropyrimidine-4,6-dione |
| HMS1598H06 |
| 5,5-diethyl-1-methyl-2-thio-barbituric acid |
| 5,5-diethyl-1-methyl-2-thioxo-dihydro-pyrimidine-4,6-dione |