vitamin A acid ethylamide structure
|
Common Name | vitamin A acid ethylamide | ||
|---|---|---|---|---|
| CAS Number | 33631-41-3 | Molecular Weight | 327.50400 | |
| Density | 0.959g/cm3 | Boiling Point | 503ºC at 760mmHg | |
| Molecular Formula | C22H33NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.3ºC | |
| Name | (2E,4E,6E,8E)-N-ethyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.959g/cm3 |
|---|---|
| Boiling Point | 503ºC at 760mmHg |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.50400 |
| Flash Point | 310.3ºC |
| Exact Mass | 327.25600 |
| PSA | 32.59000 |
| LogP | 6.49440 |
| Index of Refraction | 1.538 |
| InChIKey | WKYDOCGICAMTKE-NBIQJRODSA-N |
| SMILES | CCNC(=O)C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
|
~%
vitamin A acid ... CAS#:33631-41-3 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
|
~%
vitamin A acid ... CAS#:33631-41-3 |
| Literature: Shealy; Frye; O'Dell; Thorpe; Kirk; Coburn Jr.; Sporn Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 6 p. 745 - 751 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| all-trans-N-Ethylretinamide |
| Ro 8-4968 |
| Vitamin-A-saeureethylamid |
| Retinoic acid ethyl amide |
| Retinamide,N-ethyl-,all-trans |
| Retinamide,N-ethyl |
| Ethyl retinamide |
| Vitamin A acid ethylamide |