phenyl N-(4-chlorophenyl)methanimidate structure
|
Common Name | phenyl N-(4-chlorophenyl)methanimidate | ||
|---|---|---|---|---|
| CAS Number | 3369-35-5 | Molecular Weight | 231.67800 | |
| Density | 1.12g/cm3 | Boiling Point | 335.1ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.5ºC | |
| Name | phenyl N-(4-chlorophenyl)methanimidate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 335.1ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO |
| Molecular Weight | 231.67800 |
| Flash Point | 156.5ºC |
| Exact Mass | 231.04500 |
| PSA | 21.59000 |
| LogP | 4.07880 |
| Index of Refraction | 1.559 |
| InChIKey | QNBYXBOWHMRRAX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C=Nc2ccc(Cl)cc2)cc1 |
|
~98%
phenyl N-(4-chl... CAS#:3369-35-5 |
| Literature: Schmeyers, Jens; Toda, Fumio; Boy, Juergen; Kaupp, Gerd Journal of the Chemical Society. Perkin Transactions 2, 1998 , # 4 p. 989 - 993 |
| N-(4-Oxy-benzal)-4-chlor-anilin |
| 4-[(4-Chlor-phenylimino)-methyl]-phenol |
| p-ANISYLIDENE-p-CHLOROANILINE |
| 4-[(4-chloro-phenylimino)-methyl]-phenol |
| 4-Oxy-benzaldehyd-(4-chlor-anil) |
| phenyl N-(4-chlorophenyl)carboximidate |