phenyl N-(4-chlorophenyl)sulfonylcarbamate structure
|
Common Name | phenyl N-(4-chlorophenyl)sulfonylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 63924-78-7 | Molecular Weight | 311.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl N-(4-chlorophenyl)sulfonylcarbamate |
|---|
| Molecular Formula | C13H10ClNO4S |
|---|---|
| Molecular Weight | 311.74100 |
| Exact Mass | 311.00200 |
| PSA | 84.34000 |
| LogP | 4.10250 |
| InChIKey | LRMSGUSNBNKMGE-UHFFFAOYSA-N |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)cc1)Oc1ccccc1 |
|
~%
phenyl N-(4-chl... CAS#:63924-78-7 |
| Literature: Vigroux, Alain; Bergon, Michel; Bergonzi, Catherine; Tisnes, Pierre Journal of the American Chemical Society, 1994 , vol. 116, # 26 p. 11787 - 11796 |