2-Butanone,3,3,4,4,4-pentafluoro-1-(2-pyridinyl)- structure
|
Common Name | 2-Butanone,3,3,4,4,4-pentafluoro-1-(2-pyridinyl)- | ||
|---|---|---|---|---|
| CAS Number | 337-29-1 | Molecular Weight | 239.14200 | |
| Density | 1.382g/cm3 | Boiling Point | 199.8ºC at 760 mmHg | |
| Molecular Formula | C9H6F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74.6ºC | |
| Name | 3,3,4,4,4-pentafluoro-1-(pyridin-2-yl)butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 199.8ºC at 760 mmHg |
| Molecular Formula | C9H6F5NO |
| Molecular Weight | 239.14200 |
| Flash Point | 74.6ºC |
| Exact Mass | 239.03700 |
| PSA | 29.96000 |
| LogP | 2.39080 |
| Index of Refraction | 1.421 |
| InChIKey | BQVRBDNFCROYTC-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccn1)C(F)(F)C(F)(F)F |
|
~%
2-Butanone,3,3,... CAS#:337-29-1 |
| Literature: McGrath; Levine Journal of the American Chemical Society, 1955 , vol. 77, p. 3656 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3,4,4,4-pentadeuterio-butan-2-ol |
| 3,3,4,4,4-pentadeuterio-2-butanol |
| <3,3,4,4,4-2H5>butan-2-ol |