2-nitrophenyl dimethylcarbamate structure
|
Common Name | 2-nitrophenyl dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 3373-86-2 | Molecular Weight | 210.18700 | |
| Density | 1.292g/cm3 | Boiling Point | 321.5ºC at 760mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | (2-nitrophenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 321.5ºC at 760mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 148.2ºC |
| Exact Mass | 210.06400 |
| PSA | 75.36000 |
| LogP | 2.17840 |
| Index of Refraction | 1.558 |
| InChIKey | YGFKASVNJRLCHR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~94%
2-nitrophenyl d... CAS#:3373-86-2 |
| Literature: Liu, Zhihui; Ma, Qiaoqiao; Liu, Yuxiu; Wang, Qingmin Organic Letters, 2014 , vol. 16, # 1 p. 236 - 239 |
|
~21%
2-nitrophenyl d... CAS#:3373-86-2 |
| Literature: Barve, Balaji D.; Wu, Yang-Chang; El-Shazly, Mohamed; Chuang, Da-Wei; Cheng, Yuan-Bin; Wang, Jeh-Jeng; Chang, Fang-Rong Journal of Organic Chemistry, 2014 , vol. 79, # 7 p. 3206 - 3214 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Potentiation of fenitrothion-induced insecticidal activity against OP-resistant Chilo...
Source: ChEMBL
Target: Chilo suppressalis
External Id: CHEMBL3078274
|
| o-Nitrophenyl-N,N-dimethylcarbamat |
| 2-Nitrophenyl dimethylcarbamate |
| dimethylcarbamic acid 2-nitrophenyl ester |
| 2-Npdc |
| N,N-Dimethyl-carbamidsaeure-<2-nitro-phenylester> |
| o-nitrophenyl-N,N-dimethylcarbamate |