AKOS BC-1738 structure
|
Common Name | AKOS BC-1738 | ||
|---|---|---|---|---|
| CAS Number | 337925-74-3 | Molecular Weight | 334.16500 | |
| Density | 1.49g/cm3 | Boiling Point | 533.4ºC at 760 mmHg | |
| Molecular Formula | C15H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4ºC | |
| Name | 2-[2-(4-bromophenyl)-2-oxoethoxy]benzamide |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 533.4ºC at 760 mmHg |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.16500 |
| Flash Point | 276.4ºC |
| Exact Mass | 333.00000 |
| PSA | 69.39000 |
| LogP | 3.51000 |
| Index of Refraction | 1.623 |
| InChIKey | MMOPIDSPFSNPKK-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccccc1OCC(=O)c1ccc(Br)cc1 |
| HS Code | 2924299090 |
|---|
|
~85%
AKOS BC-1738 CAS#:337925-74-3 |
| Literature: Botros; Naguib; Osman Egyptian Journal of Chemistry, 2011 , vol. 54, # 5 p. 565 - 578 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |