4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol structure
|
Common Name | 4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol | ||
|---|---|---|---|---|
| CAS Number | 3382-63-6 | Molecular Weight | 215.223 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 370.9±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H10FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1±23.7 °C | |
| Name | 4-[(4-fluoroanilino)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 370.9±27.0 °C at 760 mmHg |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.223 |
| Flash Point | 178.1±23.7 °C |
| Exact Mass | 215.074646 |
| PSA | 32.59000 |
| LogP | 2.95 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | VNNJGDYPPLXJFF-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C=Nc2ccc(F)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925290090 |
|
~88%
4-{(E)-[(4-Fluo... CAS#:3382-63-6 |
| Literature: SCHERING CORPORATION Patent: EP1137634 B1, 2005 ; Location in patent: Page/Page column 9 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[[(p-Fluorophenyl)imino]methyl]phenol |
| 4-{(E)-[(4-Fluorophenyl)imino]methyl}phenol |
| 4-[[(4-Fluorophenyl)imino]methyl]phenol |
| MFCD00029739 |
| ALPHA-(4-FLUOROPHENYLIMINO)-P-CRESOL |
| Phenol, 4-[(E)-[(4-fluorophenyl)imino]methyl]- |
| 4-[[(4-Fluorophenyl)imino]methyl]-phenol |