Benzoic acid, 4-(hexyloxy)-, 4-hydroxyphenyl ester structure
|
Common Name | Benzoic acid, 4-(hexyloxy)-, 4-hydroxyphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 33905-64-5 | Molecular Weight | 314.37600 | |
| Density | 1.131g/cm3 | Boiling Point | 477.8ºC at 760 mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | Benzoic acid, 4-(hexyloxy)-, 4-hydroxyphenyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 477.8ºC at 760 mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.37600 |
| Flash Point | 168.6ºC |
| Exact Mass | 314.15200 |
| PSA | 55.76000 |
| LogP | 4.57050 |
| Index of Refraction | 1.558 |
| InChIKey | YIOIJLOVVKBNNA-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-hydroxyphenyl 4'-n-hexyloxybenzoate |
| 4-(4-hexyloxybenzoyloxy)phenol |
| 4-hydroxyphenyl-4'-hexyloxybenzoate |
| 4-Hydroxyphenyl-hexyloxybenzoate |
| Hydroxyphenyl-p-n-hexyloxybenzoate |
| 4-(hexyloxy) |