WAY-300505-A structure
|
Common Name | WAY-300505-A | ||
|---|---|---|---|---|
| CAS Number | 339321-57-2 | Molecular Weight | 365.41 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 565.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H20FN7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8±32.9 °C | |
Use of WAY-300505-Aantitubercular |
| Name | WAY-300505-A |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.5±60.0 °C at 760 mmHg |
| Molecular Formula | C19H20FN7 |
| Molecular Weight | 365.41 |
| Flash Point | 295.8±32.9 °C |
| Exact Mass | 365.176422 |
| LogP | 2.41 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | YHMRRBANAHZHGL-LPYMAVHISA-N |
| SMILES | CN(C)c1nc(NCc2ccccc2)nc(NN=Cc2ccccc2F)n1 |
| N'-Benzyl-6-[(2E)-2-(2-fluorobenzylidene)hydrazino]-N,N-dimethyl-1,3,5-triazine-2,4-diamine |
| Benzaldehyde, 2-fluoro-, 2-[4-(dimethylamino)-6-[(phenylmethyl)amino]-1,3,5-triazin-2-yl]hydrazone |