5-Nitro-N,N-dipropyl-1H-indole-3-methanamine structure
|
Common Name | 5-Nitro-N,N-dipropyl-1H-indole-3-methanamine | ||
|---|---|---|---|---|
| CAS Number | 3414-66-2 | Molecular Weight | 275.34600 | |
| Density | 1.165g/cm3 | Boiling Point | 424.4ºC at 760 mmHg | |
| Molecular Formula | C15H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | N-[(5-nitro-1H-indol-3-yl)methyl]-N-propylpropan-1-amine |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760 mmHg |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.34600 |
| Flash Point | 210.4ºC |
| Exact Mass | 275.16300 |
| PSA | 64.85000 |
| LogP | 4.22130 |
| Index of Refraction | 1.606 |
| InChIKey | SDTHSDKPFDQUNP-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)Cc1c[nH]c2ccc([N+](=O)[O-])cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |