5-Bromogramine structure
|
Common Name | 5-Bromogramine | ||
|---|---|---|---|---|
| CAS Number | 830-93-3 | Molecular Weight | 253.13800 | |
| Density | 1.449 g/cm3 | Boiling Point | 346.9ºC at 760 mmHg | |
| Molecular Formula | C11H13BrN2 | Melting Point | 158-162 °C | |
| MSDS | Chinese USA | Flash Point | 163.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(5-bromo-1H-indol-3-yl)-N,N-dimethylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449 g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760 mmHg |
| Melting Point | 158-162 °C |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.13800 |
| Flash Point | 163.6ºC |
| Exact Mass | 252.02600 |
| PSA | 19.03000 |
| LogP | 2.99200 |
| Index of Refraction | 1.655 |
| InChIKey | FSERHDPEOFYMMK-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1c[nH]c2ccc(Br)cc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~88%
5-Bromogramine CAS#:830-93-3 |
| Literature: Li, Shi-Guang; Zard, Samir Z. Organic Letters, 2013 , vol. 15, # 22 p. 5898 - 5901 |
|
~93%
5-Bromogramine CAS#:830-93-3 |
| Literature: DUKE UNIVERSITY Patent: WO2006/102126 A2, 2006 ; Location in patent: Page/Page column 25 ; WO 2006/102126 A2 |
|
~63%
5-Bromogramine CAS#:830-93-3 |
| Literature: Todd, Robert; Hossain, M. Mahmun Synthesis, 2009 , # 11 art. no. M07508SS, p. 1846 - 1850 |
|
~%
5-Bromogramine CAS#:830-93-3 |
| Literature: Organic and Biomolecular Chemistry, , vol. 10, # 10 p. 2101 - 2112 |
|
~%
5-Bromogramine CAS#:830-93-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 18, # 3 p. 261 - 268 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BROMOGRAMINE |
| (5-Brom-indol-3-ylmethyl)-dimethyl-amin |
| INDOLE,5-BROMO-3-(DIMETHYLAMINO)METHYL |
| 5-Bromo-N,N-dimethyl-1H-Indole-3-methanamine |
| MFCD00055980 |
| 5-Bromogramine |
| 5-bromo-3-(N,N-dimethylamino)methylindole |
| N-[(5-bromo-1H-indol-3-yl)methyl]-N,N-dimethylamine |
| (5-bromo-indol-3-ylmethyl)-dimethyl-amine |