2',3'-Dideoxythymidine structure
|
Common Name | 2',3'-Dideoxythymidine | ||
|---|---|---|---|---|
| CAS Number | 3416-05-5 | Molecular Weight | 226.229 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O4 | Melting Point | 155-156 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 155-156 °C(lit.) |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.229 |
| Exact Mass | 226.095352 |
| PSA | 84.32000 |
| LogP | -0.76 |
| Index of Refraction | 1.552 |
| InChIKey | XKKCQTLDIPIRQD-JGVFFNPUSA-N |
| SMILES | Cc1cn(C2CCC(CO)O2)c(=O)[nH]c1=O |
| Storage condition | 2~8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
|
Nicotinamide exacerbates hypoxemia in ventilator-induced lung injury independent of neutrophil infiltration.
PLoS ONE 10(4) , e0123460, (2015) Ventilator-induced lung injury is a form of acute lung injury that develops in critically ill patients on mechanical ventilation and has a high degree of mortality. Nicotinamide phosphoribosyltransfer... |
|
|
Metabolic drug-drug interaction potential of macrolactin A and 7-O-succinyl macrolactin A assessed by evaluating cytochrome P450 inhibition and induction and UDP-glucuronosyltransferase inhibition in vitro.
Antimicrob. Agents Chemother. 58(9) , 5036-46, (2014) Macrolactin A (MA) and 7-O-succinyl macrolactin A (SMA), polyene macrolides containing a 24-membered lactone ring, show antibiotic effects superior to those of teicoplanin against vancomycin-resistant... |
|
|
Cuboplexes: Topologically Active siRNA Delivery.
ACS Nano 9 , 10214-26, (2015) RNAi technology is currently experiencing a revival due to remarkable improvements in efficacy and viability through oligonucleotide chemical manipulations and/or via their packaging into nanoscale ca... |
| 1-[(2R,5S)-5-(Hydroxymethyl)tetrahydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione |
| ddT & GM-CSF |
| Thymidine,2',3'-dideoxy |
| 2'-3'-didehydro-2'-3'-dideoxythymidine |
| 1-((2R,5S)-5-(Hydroxymethyl)tetrahydrofuran-2-yl)-5-methylpyrimidine-2,4(1H,3H)-dione |
| MFCD00010570 |
| 2',3'-dideoxy-2',3'-didehydro-thymydine |
| D-3'-deoxythymidine |
| 1-[(2R,5S)-5-(Hydroxymethyl)tetrahydro-2-furanyl]-5-methyl-2,4(1H,3H)-pyrimidinedione |
| 5-methyl-2',3'-dideoxyuridine |
| 2',3'-dihydro-3'-deoxythymidine |
| 3'-DEOXYTHYMIDINE |
| Dideoxythymidine |
| 2',3'-Dideoxythymidine |
| 2,4(1H,3H)-Pyrimidinedione, 5-methyl-1-[(2R,5S)-tetrahydro-5-(hydroxymethyl)-2-furanyl]- |