5-Fluoro-2-nitrobenzoic acid structure
|
Common Name | 5-Fluoro-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 320-98-9 | Molecular Weight | 185.109 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 344.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4FNO4 | Melting Point | 131-134 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 162.0±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Fluoro-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 344.2±27.0 °C at 760 mmHg |
| Melting Point | 131-134 °C(lit.) |
| Molecular Formula | C7H4FNO4 |
| Molecular Weight | 185.109 |
| Flash Point | 162.0±23.7 °C |
| Exact Mass | 185.012436 |
| PSA | 83.12000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | GHYZIXDKAPMFCS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(F)ccc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
|
~98%
5-Fluoro-2-nitr... CAS#:320-98-9 |
| Literature: The Rockefeller University; Alteon Inc. Patent: US5514676 A1, 1996 ; |
|
~31%
5-Fluoro-2-nitr... CAS#:320-98-9 |
| Literature: Takeda Chemical Industries, Inc. Patent: US6407116 B1, 2002 ; |
|
~%
5-Fluoro-2-nitr... CAS#:320-98-9 |
| Literature: US2006/14807 A1, ; Page/Page column sheet 2; 44-45 ; US 20060014807 A1 |
|
~%
5-Fluoro-2-nitr... CAS#:320-98-9 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 33, p. 336 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
The discovery of N-cyclopropyl-4-methyl-3-[6-(4-methylpiperazin-1-yl)-4-oxoquinazolin-3(4H)-yl]benzamide (AZD6703), a clinical p38α MAP kinase inhibitor for the treatment of inflammatory diseases
Bioorg. Med. Chem. Lett. 22(12) , 3879-83, (2012) A novel, potent and selective quinazolinone series of inhibitors of p38α MAP kinase has been identified. Modifications designed to address the issues of poor aqueous solubility and high plasma protein... |
|
|
Solution and solid-phase approaches to quinconazole and fluquinconazole-inhibitors of fungal ergosterol biosynthesis. Bilokin YV and Kovalenko SM.
Heterocycl. Comm. 6(5) , 409-414, (2000)
|
| 5-fluoro-2-nitro-benzoic acid |
| 5-fluoro-2-nitorobenzoic acid |
| 5-Fluor-2-nitro-benzoesaeure |
| 2-Carboxy-4-fluoronitrobenzene |
| 5-Fluoro-2-nitrobenzoic acid |
| 2-Nitro-5-fluorobenzoic acid |
| 3-fluoro-6-nitrobenzoic acid |
| BENZOIC ACID,5-FLUORO-2-NITRO |
| MFCD00055635 |