1-(7-nitro-9H-fluoren-2-yl)ethanone structure
|
Common Name | 1-(7-nitro-9H-fluoren-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 34172-49-1 | Molecular Weight | 253.25300 | |
| Density | 1.321g/cm3 | Boiling Point | 455ºC at 760mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | 228ºC | |
| MSDS | N/A | Flash Point | 226.9ºC | |
| Name | 1-(7-nitro-9H-fluoren-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 455ºC at 760mmHg |
| Melting Point | 228ºC |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 226.9ºC |
| Exact Mass | 253.07400 |
| PSA | 62.89000 |
| LogP | 3.89180 |
| Index of Refraction | 1.655 |
| InChIKey | HCAWUAVXQVECAL-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)Cc1cc([N+](=O)[O-])ccc1-2 |
|
~%
1-(7-nitro-9H-f... CAS#:34172-49-1 |
| Literature: Oehlschlaeger; MacGregor Journal of the American Chemical Society, 1949 , vol. 71, p. 3223 |
|
~%
1-(7-nitro-9H-f... CAS#:34172-49-1 |
| Literature: Sawicki Journal of the American Chemical Society, 1954 , vol. 76, p. 2269 |
|
~%
Detail
|
| Literature: Oehlschlaeger; MacGregor Journal of the American Chemical Society, 1949 , vol. 71, p. 3223 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| 2-Acetyl-7-nitro-fluoren |
| 2-acetyl-7-nitrofluorene |
| 2-Nitro-7-acetyl-fluoren |
| 7-Nitro-2-acetyl-fluoren |
| 7-acetyl-2-nitrofluorene |