5-Azido-5-deoxy-2,3-O-isopropylideneadenosine
5-Azido-5-deoxy-2,3-O-isopropylideneadenosine structure
|
Common Name | 5-Azido-5-deoxy-2,3-O-isopropylideneadenosine | ||
|---|---|---|---|---|
| CAS Number | 34245-48-2 | Molecular Weight | 332.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine (Chinese name: 5'-Azido-5'-脱氧-2',3'-O-异丙烯基腺苷, CAS number: 34245-48-2, molecular formula: C13H16N8O3, molecular weight: 332.31800), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N8O3 |
|---|---|
| Molecular Weight | 332.31800 |
| Exact Mass | 332.13500 |
| PSA | 147.06000 |
| LogP | 1.17026 |
| InChIKey | QWAPXRJZRIFMTR-UHFFFAOYSA-N |
| SMILES | CC1(C)OC2C(CN=[N+]=[N-])OC(n3cnc4c(N)ncnc43)C2O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 2 | |
CAS#:362-75-4
CAS#:5605-63-0
CAS#:78111-39-4
CAS#:72525-45-2
CAS#:72525-43-0
CAS#:68144-26-3
CAS#:21950-36-7
CAS#:737-76-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5'-deoxy-5'-azido-2',3'-O-isopropylidene adenosine |
| 2',3'-O-isopropylidene 5'-azido 5'-deoxy adenosine |
| 5'-azido-5'-deoxy-2',3'-O-isopropylidene-adenosine |
| 5'-Azido-2'-O,3'-O-isopropylidene-5'-deoxyadenosine |
| 5'-azido-2',3'-O-isopropylidene adenosine |
| 2'-O,3'-O-Isopropylidene-5'-azido-5'-deoxyadenosine |
| 9-((3aR,4R,6R,6aR)-6-azidomethyl-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)-9H-purin-6-ylamine |
| 2'-O,3'-O-Isopropylidene-5'-deoxy-5'-azidoadenosine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: Molecular weight of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is 332.31800. |
| Q: What is the LogP of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: LogP of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is 1.17026. |
| Q: What is the molecular formula of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: Molecular formula of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is C13H16N8O3. |
| Q: What is the Chinese name of 34245-48-2? |
| A: Chinese name of 34245-48-2 is 34245-48-2. |
| Q: What is the polar surface area (PSA) of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: Polar surface area (PSA) of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is 147.06000. |
| Q: What is the InChIKey of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: InChIKey of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is QWAPXRJZRIFMTR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: Related upstream materials(CAS) of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine: 362-75-4;5605-63-0;78111-39-4;72525-45-2;72525-43-0;68144-26-3. |
| Q: What is the SMILES notation of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: SMILES notation of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is CC1(C)OC2C(CN=[N+]=[N-])OC(n3cnc4c(N)ncnc43)C2O1. |
| Q: What is the CAS number of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: CAS number of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is 34245-48-2. |
| Q: What is the English name of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine? |
| A: The English name of 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine is 5'-Azido-5'-deoxy-2',3'-O-isopropylideneadenosine. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |