6-(4-fluorophenyl)-6-oxohexanoic acid
Modify Date: 2025-08-25 15:48:45
6-(4-fluorophenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(4-fluorophenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 343319-07-3 | Molecular Weight | 224.22800 | |
| Density | 1.207g/cm3 | Boiling Point | 398.244ºC at 760 mmHg | |
| Molecular Formula | C12H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.651ºC | |
| Name | 6-(4-fluorophenyl)-6-oxohexanoic acid |
|---|
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 398.244ºC at 760 mmHg |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.22800 |
| Flash Point | 194.651ºC |
| Exact Mass | 224.08500 |
| PSA | 54.37000 |
| LogP | 2.65340 |
| Index of Refraction | 1.519 |
| InChIKey | BCUYYQNETZAUOP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCC(=O)c1ccc(F)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
6-(4-fluorophen... CAS#:343319-07-3 |
| Literature: WO2006/121861 A2, ; Page/Page column 203-204 ; WO 2006/121861 A2 |
|
~%
6-(4-fluorophen... CAS#:343319-07-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 22, # 12 p. 1460 - 1464 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |