6-(4-ethylphenyl)-6-oxohexanoic acid structure
|
Common Name | 6-(4-ethylphenyl)-6-oxohexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 502651-40-3 | Molecular Weight | 234.29100 | |
| Density | 1.093g/cm3 | Boiling Point | 422.704ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.59ºC | |
| Name | 6-(4-ethylphenyl)-6-oxohexanoic acid |
|---|
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 422.704ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 223.59ºC |
| Exact Mass | 234.12600 |
| PSA | 54.37000 |
| LogP | 3.07670 |
| Index of Refraction | 1.527 |
| InChIKey | CFEOGPIWHAUYRZ-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)CCCCC(=O)O)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |