4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-carbaldehyde structure
|
Common Name | 4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 343604-24-0 | Molecular Weight | 250.216 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 323.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1±19.4 °C | |
| Name | 3-[4-(trifluoromethyl)phenyl]benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.8±42.0 °C at 760 mmHg |
| Molecular Formula | C14H9F3O |
| Molecular Weight | 250.216 |
| Flash Point | 158.1±19.4 °C |
| Exact Mass | 250.060547 |
| PSA | 17.07000 |
| LogP | 4.37 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | JLQBHCYLEQJWCE-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
|
~84%
4'-(Trifluorome... CAS#:343604-24-0 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/118542 A1, 2005 ; Location in patent: Page/Page column 45-46 ; WO 2005/118542 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2-(4'-(trifluoromethyl)-[1,1'-biphenyl]-3-yl)acetaldehyde |
| 4′-(Trifluoromethyl)biphenyl-3-carboxaldehyde |
| MFCD01631879 |
| [1,1'-Biphenyl]-3-carboxaldehyde, 4'-(trifluoromethyl)- |
| 4'-(trifluoromethyl)[1,1'-biphenyl]-3-carbaldehyde |
| 4'-(Trifluoromethyl)biphenyl-3-carbaldehyde |
| 3-(4-trifluoromethyl-phenyl)-benzaldehyde |
| 4'-Trifluoromethyl-biphenyl-3-carbaldehyde |
| 4'-(Trifluoromethyl)-3-biphenylcarbaldehyde |
| 4'-trifluoromethylbiphenyl-3-carboxaldehyde |