1-nitro-2-pent-1-ynylbenzene structure
|
Common Name | 1-nitro-2-pent-1-ynylbenzene | ||
|---|---|---|---|---|
| CAS Number | 344412-67-5 | Molecular Weight | 189.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-nitro-2-pent-1-ynylbenzene |
|---|
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21100 |
| Exact Mass | 189.07900 |
| PSA | 45.82000 |
| LogP | 3.26960 |
| InChIKey | HQHYDYGGPVIZCZ-UHFFFAOYSA-N |
| SMILES | CCCC#Cc1ccccc1[N+](=O)[O-] |
|
~93%
1-nitro-2-pent-... CAS#:344412-67-5 |
| Literature: EP2740730 A1, ; Page/Page column ; |
|
~54%
1-nitro-2-pent-... CAS#:344412-67-5 |
| Literature: Larock, Richard C.; Harrison, L. Wayne Journal of the American Chemical Society, 1984 , vol. 106, # 15 p. 4218 - 4227 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |