1-BROMO-2,4-DIFLUORO-5-NITROBENZENE structure
|
Common Name | 1-BROMO-2,4-DIFLUORO-5-NITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 345-24-4 | Molecular Weight | 237.986 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 252.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H2BrF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.5±25.9 °C | |
| Name | 1-bromo-2,4-difluoro-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.4±35.0 °C at 760 mmHg |
| Molecular Formula | C6H2BrF2NO2 |
| Molecular Weight | 237.986 |
| Flash Point | 106.5±25.9 °C |
| Exact Mass | 236.923691 |
| PSA | 45.82000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | OOUUWURPSUSDTD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(F)cc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-bromo-2,4-difluoro-5-nitro-benzene |
| 5-bromo-2,4-difluoro-1-nitrobenzene |
| bromodifluoronitrobenzene |
| MFCD00129166 |
| 1-Brom-2,4-difluor-5-nitro-benzol |
| 1-BROMO-2,4-DIFLUORO-5-NITROBENZENE |
| 5-Bromo-2,4-difluoronitrobenzene |