4-(1,3-dioxoisoindol-2-yl)butanamide structure
|
Common Name | 4-(1,3-dioxoisoindol-2-yl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 3459-33-4 | Molecular Weight | 232.23500 | |
| Density | 1.334g/cm3 | Boiling Point | 478.9ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.4ºC | |
| Name | 4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 478.9ºC at 760 mmHg |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.23500 |
| Flash Point | 243.4ºC |
| Exact Mass | 232.08500 |
| PSA | 81.46000 |
| LogP | 1.63570 |
| Index of Refraction | 1.603 |
| InChIKey | DEHGEJYFWZKPKM-UHFFFAOYSA-N |
| SMILES | NC(=O)CCCN1C(=O)c2ccccc2C1=O |
| HS Code | 2925190090 |
|---|
|
~82%
4-(1,3-dioxoiso... CAS#:3459-33-4 |
| Literature: Usifoh, Cyril O.; Lambert, Didier M.; Wouters, Johan; Scriba, Gerhard K.E. Archiv der Pharmazie, 2001 , vol. 334, # 10 p. 323 - 331 |
|
~%
4-(1,3-dioxoiso... CAS#:3459-33-4 |
| Literature: Usifoh, Cyril O.; Lambert, Didier M.; Wouters, Johan; Scriba, Gerhard K.E. Archiv der Pharmazie, 2001 , vol. 334, # 10 p. 323 - 331 |
|
~%
4-(1,3-dioxoiso... CAS#:3459-33-4 |
| Literature: Usifoh, Cyril O.; Lambert, Didier M.; Wouters, Johan; Scriba, Gerhard K.E. Archiv der Pharmazie, 2001 , vol. 334, # 10 p. 323 - 331 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-phthalimido-butyric acid amide |
| 4-phthalimido-butyramide |
| 2-ISOINDOLINEBUTYRAMIDE,1,3-DIOXO |
| 2H-Isoindole-2-butanamide,1,3-dihydro-1,3-dioxo |
| 1,3-Dioxo-2-isoindolinebutyramide |
| 4-Phthalimido-buttersaeure-amid |