1-(4-Nitrophenyl)-pyrazole structure
|
Common Name | 1-(4-Nitrophenyl)-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 3463-30-7 | Molecular Weight | 189.171 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 331.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.5±23.2 °C | |
| Name | 1-(4-nitrophenyl)pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.8±25.0 °C at 760 mmHg |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.171 |
| Flash Point | 154.5±23.2 °C |
| Exact Mass | 189.053833 |
| PSA | 63.64000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | PNWPAZGIVRZAER-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-n2cccn2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole, 1-(4-nitrophenyl)- |
| 1-nitrophenylpyrazole |
| (4-nitrophenyl)pyrazole |
| 1-(4-Nitrophenyl)-1H-pyrazole |
| 1-(4-Nitrophenyl)-pyrazole |
| PYRAZOLE1pnitrophenyl |
| 1-p-nitrophenylpyrazole |
| 1-(4'-nitrophenyl)pyrazole |