4-Chloro-2-nitrobenzonitrile structure
|
Common Name | 4-Chloro-2-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 34662-32-3 | Molecular Weight | 182.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 313.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H3ClN2O2 | Melting Point | 99-101ºC | |
| MSDS | Chinese USA | Flash Point | 143.4±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-2-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.5±27.0 °C at 760 mmHg |
| Melting Point | 99-101ºC |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.564 |
| Flash Point | 143.4±23.7 °C |
| Exact Mass | 181.988312 |
| PSA | 69.61000 |
| LogP | 1.97 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | OZKOAADVLVCNFO-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(Cl)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
|
~92%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: Kreimeyer, Annett; Laube, Bodo; Sturgess, Mike; Goeldner, Maurice; Foucaud, Bernard Journal of Medicinal Chemistry, 1999 , vol. 42, # 21 p. 4394 - 4404 |
|
~%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: US4528143 A1, ; |
|
~%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 21 p. 4394 - 4404 |
|
~%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 21 p. 4394 - 4404 |
|
~%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: Journal of the Chemical Society, , p. 232,236 |
|
~%
4-Chloro-2-nitr... CAS#:34662-32-3 |
| Literature: Journal of the Chemical Society, , p. 1521,1524 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Chloro-2-cyanonitrobenzene |
| EINECS 252-133-0 |
| MFCD00027398 |
| 2-Nitro-4-chlorobenzonitrile |
| 4-Chlor-2-nitro-benzonitril |
| 2-Nitro-4-chlor-benzonitril |
| 4-Chloro-2-nitrobenzonitrile |
| Benzonitrile, 4-chloro-2-nitro- |
| 4-chloro-2-nitro-benzonitrile |
| 4-Chloro-2-nitrobenzonitril |