Benzeneacetic acid, a-phenyl-, ethyl ester structure
|
Common Name | Benzeneacetic acid, a-phenyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3468-99-3 | Molecular Weight | 240.29700 | |
| Density | 1.079g/cm3 | Boiling Point | 336.9ºC at 760mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 170-171℃ | |
| MSDS | N/A | Flash Point | 131.2ºC | |
| Name | ethyl 2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 336.9ºC at 760mmHg |
| Melting Point | 170-171℃ |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 131.2ºC |
| Exact Mass | 240.11500 |
| PSA | 26.30000 |
| LogP | 3.38160 |
| Index of Refraction | 1.553 |
| InChIKey | PYPHPZOQIVEWHN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Diphenylacetic acid,ethyl ester |
| Diphenyl-essigsaeure-aethylester |
| Ethyl diphenylacetate |
| Acetic acid,diphenyl-,ethyl ester |