2,3,4-Trichlorobenzenesulfonyl chloride structure
|
Common Name | 2,3,4-Trichlorobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 34732-09-7 | Molecular Weight | 279.956 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 349.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl4O2S | Melting Point | 63-65°C | |
| MSDS | Chinese USA | Flash Point | 165.4±27.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2,3,4-trichlorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.9±42.0 °C at 760 mmHg |
| Melting Point | 63-65°C |
| Molecular Formula | C6H2Cl4O2S |
| Molecular Weight | 279.956 |
| Flash Point | 165.4±27.9 °C |
| Exact Mass | 277.852966 |
| PSA | 42.52000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | JDAJYNHGBUXIKS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(Cl)c(Cl)c1Cl |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S36/37/39-S45-S30-S23-S22-S28 |
| RIDADR | 1759 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 252-174-4 |
| Benzenesulfonyl chloride, 2,3,4-trichloro- |
| 2,3,4-trichlorobenzene-1-sulfonyl chloride |
| 2,3,4-Trichlorobenzenesulfonyl chloride |
| MFCD00024871 |
| 2,3,4-trichlorobenzenesulfonylchloride |
| 2,3,4-trichlorophenylsulfonyl chloride |
| Benzenesulfonyl chloride,2,3,4-trichloro |
| 2,3,4-Trichlor-benzolsulfonylchlorid |
| 2,3,4-trichlorobenzenesulphonylchloride |
| 2,3,4,5,6-PENTACHLOROPHENYL 2,4-DICHLOROBENZOATE |