Butanedioic acid,2-phenyl-, 1,4-diethyl ester structure
|
Common Name | Butanedioic acid,2-phenyl-, 1,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 34861-81-9 | Molecular Weight | 250.29000 | |
| Density | 1.092g/cm3 | Boiling Point | 333.6ºC at 760mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6ºC | |
| Name | diethyl 2-phenylbutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 333.6ºC at 760mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 159.6ºC |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.28650 |
| Index of Refraction | 1.498 |
| InChIKey | JVQDNCKPHSZFSO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(=O)OCC)c1ccccc1 |
| HS Code | 2917399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diethyl 2-phenyl-succinate |
| phenylbutanedioic acid diethyl ester |
| diethyl phenylsucinnate |
| diethyl phenylsuccinate |