N-TOSYL-4-CHLORO-2-IODO-7-AZAINDOLE structure
|
Common Name | N-TOSYL-4-CHLORO-2-IODO-7-AZAINDOLE | ||
|---|---|---|---|---|
| CAS Number | 348640-26-6 | Molecular Weight | 432.66400 | |
| Density | 1.846g/cm3 | Boiling Point | 544.829ºC at 760 mmHg | |
| Molecular Formula | C14H10ClIN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.303ºC | |
| Name | 4-chloro-2-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.846g/cm3 |
|---|---|
| Boiling Point | 544.829ºC at 760 mmHg |
| Molecular Formula | C14H10ClIN2O2S |
| Molecular Weight | 432.66400 |
| Flash Point | 283.303ºC |
| Exact Mass | 431.92000 |
| PSA | 60.34000 |
| LogP | 4.92050 |
| Index of Refraction | 1.727 |
| InChIKey | OOZQRJFRYLCREJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2c(I)cc3c(Cl)ccnc32)cc1 |
|
~%
N-TOSYL-4-CHLOR... CAS#:348640-26-6 |
| Literature: Chemical Biology and Drug Design, , vol. 76, # 2 p. 100 - 106 |
|
~%
N-TOSYL-4-CHLOR... CAS#:348640-26-6 |
| Literature: Chemical Biology and Drug Design, , vol. 76, # 2 p. 100 - 106 |
|
~%
N-TOSYL-4-CHLOR... CAS#:348640-26-6 |
| Literature: Chemical Biology and Drug Design, , vol. 76, # 2 p. 100 - 106 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Tosyl-4-chloro-2-iodo-7-azaindole |