1-Bromo-2-nitro-4-(trifluoromethyl)benzene structure
|
Common Name | 1-Bromo-2-nitro-4-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 349-03-1 | Molecular Weight | 270.003 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 225.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H3BrF3NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 90.4±25.9 °C | |
| Name | 4-Bromo-3-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 225.9±35.0 °C at 760 mmHg |
| Molecular Formula | C7H3BrF3NO2 |
| Molecular Weight | 270.003 |
| Flash Point | 90.4±25.9 °C |
| Exact Mass | 268.929932 |
| PSA | 45.82000 |
| LogP | 2.94 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | PESPBNYBZVIGRO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Br |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904909090 |
|
~37%
1-Bromo-2-nitro... CAS#:349-03-1 |
| Literature: Bayer CropScience S.A. Patent: US6635780 B1, 2003 ; Location in patent: Page/Page column 12 ; |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
J. Heterocycl. Chem. 27 , 351, (1990)
|
| 3-NITRO-4-BROMOTRIFLUOROMETHYLBENZENE |
| 4-BroMo-3-nitro-trifluoroMethyl |
| 2-Nitro-4-(trifluoromethyl)bromobenzene |
| Toluene, 4-bromo-α,α,α-trifluoro-3-nitro- |
| 2-Bromo-5-trifluoromethyl-1-nitrobenzene |
| 1-Bromo-2-nitro-4-(trifluoromethyl)benzene |
| MFCD00014685 |
| 4-Bromo-3-nitrobenzotrifluoride |
| 4-Bromo-α,α,α-trifluoro-3-nitrotoluene |
| Benzene, 1-bromo-2-nitro-4-(trifluoromethyl)- |
| WNR BE EXFFF |
| 3-nitro-4-broMotrifluorotoluol |
| 3-NITRO-4-BROMOBENZOTRIFLUORIDE |
| 2-Bromo-5-(trifluoromethyl)nitrobenzene |
| 1-bromo-2-nitro-4-trifluoromethylbenzene |
| 4-bromo-3-nitro-1-trifluoromethylbenzene |