boron tris(trifluoroacetate)
Modify Date: 2025-08-25 23:13:52
boron tris(trifluoroacetate) structure
|
Common Name | boron tris(trifluoroacetate) | ||
|---|---|---|---|---|
| CAS Number | 350-70-9 | Molecular Weight | 349.85700 | |
| Density | 1.672g/cm3 | Boiling Point | 116.7ºC at 760mmHg | |
| Molecular Formula | C6BF9O6 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 24.4ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | bis[(2,2,2-trifluoroacetyl)oxy]boranyl 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672g/cm3 |
|---|---|
| Boiling Point | 116.7ºC at 760mmHg |
| Molecular Formula | C6BF9O6 |
| Molecular Weight | 349.85700 |
| Flash Point | 24.4ºC |
| Exact Mass | 349.96400 |
| PSA | 78.90000 |
| LogP | 1.28780 |
| Appearance of Characters | Liquid | Yellow to orange to brown |
| Index of Refraction | 1.307 |
| InChIKey | CWBHKBKGKCDGDM-UHFFFAOYSA-N |
| SMILES | O=C(OB(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F)C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 20/21/22-34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 1742 8/PG 2 |
| Packaging Group | II |
|
~%
boron tris(trif... CAS#:350-70-9 |
| Literature: Prato; Soombar; Vazquez; Niziol; Gondek; Rau; Kajzar Molecular Crystals and Liquid Crystals, 2010 , vol. 521, p. 253 - 264 |
|
~78%
boron tris(trif... CAS#:350-70-9
Detail
|
| Literature: Olah; Wu Synthesis, 1991 , # 3 p. 204 - 206 |
|
~%
boron tris(trif... CAS#:350-70-9 |
| Literature: Du Pont de Nemours and Co. Patent: US2782233 , 1955 ; |
|
~%
boron tris(trif... CAS#:350-70-9 |
| Literature: Gmelin Handbook: B: B-Verb.9, 5.2.4, page 189 - 199 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
CAS#:330-25-6
CAS#:2314-97-8
CAS#:60669-28-5![1-methyl-4-[2,2,2-trifluoro-1,1-bis(4-methylphenyl)ethyl]benzene structure](https://image.chemsrc.com/caspic/403/61204-09-9.png)
CAS#:61204-09-9| EINECS 206-507-5 |
| Boron tris(trifluoroacetate) |
| MFCD00000415 |
| BTFA Tris[trifluoroacetoxy]borane |