2-(3-fluoro-6-oxocyclohexa-2,4-dien-1-ylidene)-1,5-dihydro-1,5-benzodiazepin-4-one structure
|
Common Name | 2-(3-fluoro-6-oxocyclohexa-2,4-dien-1-ylidene)-1,5-dihydro-1,5-benzodiazepin-4-one | ||
|---|---|---|---|---|
| CAS Number | 351003-09-3 | Molecular Weight | 270.25800 | |
| Density | 1.38g/cm3 | Boiling Point | 489.7ºC at 760 mmHg | |
| Molecular Formula | C15H11FN2O2 | Melting Point | 278-282ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 250ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-fluoro-6-oxocyclohexa-2,4-dien-1-ylidene)-1,5-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 489.7ºC at 760 mmHg |
| Melting Point | 278-282ºC(lit.) |
| Molecular Formula | C15H11FN2O2 |
| Molecular Weight | 270.25800 |
| Flash Point | 250ºC |
| Exact Mass | 270.08000 |
| PSA | 61.69000 |
| LogP | 2.56790 |
| Index of Refraction | 1.654 |
| InChIKey | ZFMHDLXJLIJMEW-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2cc(F)ccc2O)=Nc2ccccc2N1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dihydro-4-(5-fluoro-2-hydroxyphenyl)-2H-1,5-benzodiazepin-2-one |
| MFCD03070537 |
| 4-(5-Fluoro-2-hydroxyphenyl)-1H-benzo[b][1,4]diazepin-2(3H)-one |