cyclohexylmethylmagnesium bromide structure
|
Common Name | cyclohexylmethylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 35166-78-0 | Molecular Weight | 201.38700 | |
| Density | 0.966 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C7H13BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -17 °C | |
| Name | magnesium,methanidylcyclohexane,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966 g/mL at 25 °C |
|---|---|
| Molecular Formula | C7H13BrMg |
| Molecular Weight | 201.38700 |
| Flash Point | -17 °C |
| Exact Mass | 200.00500 |
| LogP | 3.37990 |
| Appearance of Characters | Solution | Colorless to yellow to brown |
| InChIKey | UFQSTBGEWZUCBQ-UHFFFAOYSA-M |
| SMILES | [Br-].[CH2-]C1CCCCC1.[Mg+2] |
| Storage condition | 2~8 ℃ |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| HS Code | 2931900090 |
|
~%
cyclohexylmethy... CAS#:35166-78-0 |
| Literature: US5594023 A1, ; |
|
~%
cyclohexylmethy... CAS#:35166-78-0 |
| Literature: WO2005/118542 A1, ; Page/Page column 54 ; WO 2005/118542 A1 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (Cyclohexylmethyl)magnesium bromide solution |
| Cyclohexylmethylmagnesium bromide |
| Cyclohexylmethylmagnesium bromide 0.25 M in Tetrahydrofuran |
| cyclohexylcarbinylmagnesium bromide |
| methylcyclohexylmagnesium bromide |
| bromo(cyclohexylmethyl)magnesium |
| (cyclohexylmethyl)magnesium bromide |