4-(4-Methoxyphenoxy)benzoic acid structure
|
Common Name | 4-(4-Methoxyphenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3525-22-2 | Molecular Weight | 244.24300 | |
| Density | 1.242g/cm3 | Boiling Point | 401.1ºC at 760 mmHg | |
| Molecular Formula | C14H12O4 | Melting Point | 178-183ºC | |
| MSDS | Chinese USA | Flash Point | 152.8ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 4-(4-Methoxyphenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 401.1ºC at 760 mmHg |
| Melting Point | 178-183ºC |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24300 |
| Flash Point | 152.8ºC |
| Exact Mass | 244.07400 |
| PSA | 55.76000 |
| LogP | 3.18570 |
| Index of Refraction | 1.589 |
| InChIKey | COMKNVCMWUGEPO-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(C(=O)O)cc2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H400 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 22-43-50/53 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD02272298 |