Fmoc-Phe(2-CF3)-OH structure
|
Common Name | Fmoc-Phe(2-CF3)-OH | ||
|---|---|---|---|---|
| CAS Number | 352523-16-1 | Molecular Weight | 455.426 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 609.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H20F3NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 322.7±31.5 °C | |
| Name | Fmoc-2-(trifluoromethyl)-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.9±55.0 °C at 760 mmHg |
| Molecular Formula | C25H20F3NO4 |
| Molecular Weight | 455.426 |
| Flash Point | 322.7±31.5 °C |
| Exact Mass | 455.134430 |
| PSA | 75.63000 |
| LogP | 5.98 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | KSQOLKMHJFBQNA-QFIPXVFZSA-N |
| SMILES | O=C(NC(Cc1ccccc1C(F)(F)F)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-2-(trifluoromethyl)- |
| Fmoc-Phe(2-CF3)-OH |
| MFCD01863052 |
| (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(trifluoromethyl)phenyl]propanoic acid |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-(trifluoromethyl)-L-phenylalanine |
| FMoc-L-2-trifluoroMethylphenylalanine |