(4-chlorophenyl)-(3-methylphenyl)methanone structure
|
Common Name | (4-chlorophenyl)-(3-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 35256-82-7 | Molecular Weight | 230.69000 | |
| Density | 1.178g/cm3 | Boiling Point | 361.8ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | (4-chlorophenyl)-(3-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760 mmHg |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69000 |
| Flash Point | 196.3ºC |
| Exact Mass | 230.05000 |
| PSA | 17.07000 |
| LogP | 3.87940 |
| Index of Refraction | 1.586 |
| InChIKey | QNLZAQKYBMIIPN-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)c2ccc(Cl)cc2)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-methyl-4'-chlorobenzophenone |
| 4-Chlor-3'-methyl-benzophenon |
| 3-Methyl-4'-chlorbenzophenon |
| 4-Chloro-3'-methylbenzophenone |