1-(3-methoxybenzoyl)piperidine-4-carboxylic acid
Modify Date: 2025-08-31 20:51:58
1-(3-methoxybenzoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(3-methoxybenzoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 353465-22-2 | Molecular Weight | 263.28900 | |
| Density | 1.249g/cm3 | Boiling Point | 485.4ºC at 760 mmHg | |
| Molecular Formula | C14H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 1-(3-methoxybenzoyl)piperidine-4-carboxylic acid |
|---|
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 485.4ºC at 760 mmHg |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.28900 |
| Flash Point | 247.3ºC |
| Exact Mass | 263.11600 |
| PSA | 66.84000 |
| LogP | 1.56990 |
| Index of Refraction | 1.568 |
| InChIKey | TZQZLEXNQVSXDV-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)N2CCC(C(=O)O)CC2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |