1-(3-Chlorobenzoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(3-Chlorobenzoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 401581-33-7 | Molecular Weight | 267.70800 | |
| Density | 1.347g/cm3 | Boiling Point | 479.7ºC at 760 mmHg | |
| Molecular Formula | C13H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9ºC | |
| Name | 1-(3-Chlorobenzoyl)piperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 479.7ºC at 760 mmHg |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.70800 |
| Flash Point | 243.9ºC |
| Exact Mass | 267.06600 |
| PSA | 57.61000 |
| LogP | 2.21470 |
| Index of Refraction | 1.592 |
| InChIKey | VVWYNFSSQNAKLL-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CCN(C(=O)c2cccc(Cl)c2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[(3-chlorophenyl)carbonyl]piperidine-4-carboxylic acid |