1-(3-methylbutanoyl)piperidine-4-carboxylic acid
Modify Date: 2025-09-17 18:46:42
1-(3-methylbutanoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(3-methylbutanoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 926238-85-9 | Molecular Weight | 213.27300 | |
| Density | 1.117g/cm3 | Boiling Point | 392.543ºC at 760 mmHg | |
| Molecular Formula | C11H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.203ºC | |
| Name | 1-(3-methylbutanoyl)piperidine-4-carboxylic acid |
|---|
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 392.543ºC at 760 mmHg |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.27300 |
| Flash Point | 191.203ºC |
| Exact Mass | 213.13600 |
| PSA | 57.61000 |
| LogP | 1.29360 |
| Index of Refraction | 1.496 |
| InChIKey | WTTTVJRTMHFDHO-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)N1CCC(C(=O)O)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |