[(2-oxo-1,2-diphenyl-ethylidene)amino]urea
![[(2-oxo-1,2-diphenyl-ethylidene)amino]urea Structure](https://image.chemsrc.com/caspic/156/3540-90-7.png)
[(2-oxo-1,2-diphenyl-ethylidene)amino]urea structure
|
Common Name | [(2-oxo-1,2-diphenyl-ethylidene)amino]urea | ||
|---|---|---|---|---|
| CAS Number | 3540-90-7 | Molecular Weight | 267.28300 | |
| Density | 1.22g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2-oxo-1,2-diphenylethylidene)amino]urea |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.22g/cm3 |
|---|---|
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.28300 |
| Exact Mass | 267.10100 |
| PSA | 84.55000 |
| LogP | 3.03310 |
| Index of Refraction | 1.617 |
| InChIKey | MMLCFKQQWFOXNC-GHRIWEEISA-N |
| SMILES | NC(=O)NN=C(C(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[(2-oxo-1,2-dip... CAS#:3540-90-7 |
| Literature: Biltz; Arnd Justus Liebigs Annalen der Chemie, 1905 , vol. 339, p. 244,250, 252, 256 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:4512-00-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzilmonothiosemicarbazone |
| Benzil-mono-thiosemicarbazon |
| benzil monotosylhydrazone |
| bisbenzoylthiosemicarbazone |
| Benzilmonosemicarbazon |
| benzil mono-semicarbazone |
| benzil semicarbazone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: The English name of [(2-oxo-1,2-diphenylethylidene)amino]urea is [(2-oxo-1,2-diphenylethylidene)amino]urea. |
| Q: What is the InChIKey of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: InChIKey of [(2-oxo-1,2-diphenylethylidene)amino]urea is MMLCFKQQWFOXNC-GHRIWEEISA-N. |
| Q: What is the CAS number of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: CAS number of [(2-oxo-1,2-diphenylethylidene)amino]urea is 3540-90-7. |
| Q: What is the molecular weight of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: Molecular weight of [(2-oxo-1,2-diphenylethylidene)amino]urea is 267.28300. |
| Q: What is the polar surface area (PSA) of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: Polar surface area (PSA) of [(2-oxo-1,2-diphenylethylidene)amino]urea is 84.55000. |
| Q: What English synonyms does [(2-oxo-1,2-diphenylethylidene)amino]urea have? |
| A: English synonyms of [(2-oxo-1,2-diphenylethylidene)amino]urea: benzilmonothiosemicarbazone, Benzil-mono-thiosemicarbazon, benzil monotosylhydrazone, bisbenzoylthiosemicarbazone, Benzilmonosemicarbazon, benzil mono-semicarbazone, benzil semicarbazone. |
| Q: What is the molecular formula of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: Molecular formula of [(2-oxo-1,2-diphenylethylidene)amino]urea is C15H13N3O2. |
| Q: What is the Chinese name of 3540-90-7? |
| A: Chinese name of 3540-90-7 is 3540-90-7. |
| Q: What is the LogP of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: LogP of [(2-oxo-1,2-diphenylethylidene)amino]urea is 3.03310. |
| Q: What are the downstream products of [(2-oxo-1,2-diphenylethylidene)amino]urea? |
| A: Related downstream products(CAS) of [(2-oxo-1,2-diphenylethylidene)amino]urea: 4512-00-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |