N-[(2-nitrophenyl)methyl]cycloheptanamine structure
|
Common Name | N-[(2-nitrophenyl)methyl]cycloheptanamine | ||
|---|---|---|---|---|
| CAS Number | 355382-89-7 | Molecular Weight | 248.32100 | |
| Density | 1.11g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.9ºC | |
| Name | N-[(2-nitrophenyl)methyl]cycloheptanamine |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.32100 |
| Flash Point | 178.9ºC |
| Exact Mass | 248.15200 |
| PSA | 57.85000 |
| LogP | 4.32130 |
| Index of Refraction | 1.554 |
| InChIKey | ZDTUMDFAPMJSSH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CNC1CCCCCC1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |